| Name |
3-Epitaraxerol Epitaraxerol |
| Formula |
C30H50O |
| Mw |
426.38616622 |
| CAS RN |
20460-33-7 |
| C_ID |
C00019226
, 
|
| InChIKey |
GGGUGZHBAOMSFJ-DRFFVYLWNA-N |
| InChICode |
InChI=1S/C30H50O/c1-25(2)17-18-27(5)13-9-21-29(7)14-10-20-26(3,4)24(31)12-16-28(20,6)22(29)11-15-30(21,8)23(27)19-25/h9,20,22-24,31H,10-19H2,1-8H3/t20-,22+,23+,24+,27-,28-,29-,30+/m0/s1 |
| SMILES |
CC1(C)CC[C@]2(C)CC=C3[C@]4(C)CC[C@H]5C(C)(C)[C@H](O)CC[C@]5(C)[C@H]4CC[C@@]3(C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Adhatoda vasica  | Ref. |
| Plantae | Euphorbiaceae | Excoecaria agallocha L.  | Ref. |
| Plantae | Euphorbiaceae | Macaranga triloba | Ref. |
|
|
zoom in
| Organism | Adhatoda vasica | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|