| Name |
Torvanol A 4-Sulfate-2'-hydroxy-6,3'-dimethoxy-5'-(2-propenoic acid)isoflavone |
| Formula |
C20H20O10S |
| Mw |
452.07771759 |
| CAS RN |
438050-67-0 |
| C_ID |
C00019212
, 
|
| InChIKey |
XKGLTSPFQHSIDD-XCYBSYLXNA-N |
| InChICode |
InChI=1S/C20H20O10S/c1-27-12-4-5-16-14(9-12)20(30-31(24,25)26)15(10-29-16)13-7-11(3-6-18(21)22)8-17(28-2)19(13)23/h3-9,15,20,23H,10H2,1-2H3,(H,21,22)(H,24,25,26)/b6-3+/t15-,20+/m1/s1 |
| SMILES |
COc1ccc2c(c1)[C@H](OS(=O)(=O)O)[C@@H](c1cc(/C=C/C(=O)O)cc(OC)c1O)CO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Solanum nigrum  | Ref. |
| Plantae | Solanaceae | Solanum torvum  | Ref. |
|
|
zoom in
| Organism | Solanum nigrum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|