| Name |
Licofuranocoumarin 2,4'-Dihydroxy-5-methoxy-5''-(1-hydroxy-1-methylethyl)-4'',5''-dihydrofurano[2'',3'':7,6]-3-phenylcoumarin |
| Formula |
C21H20O7 |
| Mw |
384.12090299 |
| CAS RN |
329319-07-5 |
| C_ID |
C00018989
, 
|
| InChIKey |
GAUFLNQQCSXBPK-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C21H20O7/c1-21(2,25)18-8-14-16(27-18)9-17-13(19(14)26-3)7-12(20(24)28-17)11-5-4-10(22)6-15(11)23/h4-7,9,18,22-23,25H,8H2,1-3H3/t18-/m1/s1 |
| SMILES |
COc1c2c(cc3oc(=O)c(-c4ccc(O)cc4O)cc13)OC(C(C)(C)O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza glabra | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|