| Name |
Juncunone |
| Formula |
C18H18O3 |
| Mw |
282.12559444 |
| CAS RN |
77305-81-8 |
| C_ID |
C00015800
, 
|
| InChIKey |
KDADJLHRXRSXQU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H18O3/c1-9-8-12-4-5-13-10(2)15(20)7-6-14(13)17(12)16(11(3)19)18(9)21/h6-8,20-21H,4-5H2,1-3H3 |
| SMILES |
CC(=O)c1c(O)c(C)cc2c1-c1ccc(O)c(C)c1CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Juncaceae | Juncus effusus  | Ref. |
| Plantae | Juncaceae | Juncus roemerianus | Ref. |
|
|
zoom in
| Organism | Juncus effusus |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
