| Name |
Resveratroloside 3,4',5-Trihydroxystilbene 4'-O-beta-D-glucopyranoside Resveratrol 4'-O-beta-D-glucopyranoside |
| Formula |
C20H22O8 |
| Mw |
390.13146768 |
| CAS RN |
38963-95-0 |
| C_ID |
C00015300
, 
|
| InChIKey |
RUOKEYJFAJITAG-UAIPQYJBNA-N |
| InChICode |
InChI=1S/C20H22O8/c21-10-16-17(24)18(25)19(26)20(28-16)27-15-5-3-11(4-6-15)1-2-12-7-13(22)9-14(23)8-12/h1-9,16-26H,10H2/b2-1+/t16-,17+,18+,19-,20-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2ccc(/C=C/c3cc(O)cc(O)c3)cc2)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Polygonaceae | Polygonum sachalinensis | Ref. |
| Plantae | Polygonaceae | Rheum maximowiczii | Ref. |
| Plantae | Polygonaceae | Rheum rhaponticum  | Ref. |
| Plantae | Vitaceae | Ampelopsis brevipedunculata var hancei  | Ref. |
| - | - | Rhizoma rhei | Ref. |
|
|
zoom in
| Organism | Polygonum cuspidatum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|