| Name |
Gancaonin R 2,6-Diisopentenyl-3,3'4',5-Tetrahydroxybibenzyl |
| Formula |
C24H30O4 |
| Mw |
382.21440945 |
| CAS RN |
134958-53-5 |
| C_ID |
C00015247
, 
|
| InChIKey |
QFAPONVNJTUMHF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C24H30O4/c1-15(2)5-9-19-18(11-7-17-8-12-21(25)24(28)13-17)20(10-6-16(3)4)23(27)14-22(19)26/h5-6,8,12-14,25-28H,7,9-11H2,1-4H3 |
| SMILES |
CC(C)=CCc1c(O)cc(O)c(CC=C(C)C)c1CCc1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza glabra | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|