| Name |
Licoagrochalcone A
3-Prenyl-4,2',4'-trihydroxychalcone |
| Formula |
C20H20O4 |
| Mw |
324.13615913 |
| CAS RN |
202815-28-9 |
| C_ID |
C00014456
, 
|
| InChIKey |
TVUGLERLRIQATC-BJMVGYQFSA-N |
| InChICode |
InChI=1S/C20H20O4/c1-13(2)3-6-15-11-14(4-9-18(15)22)5-10-19(23)17-8-7-16(21)12-20(17)24/h3-5,7-12,21-22,24H,6H2,1-2H3/b10-5+ |
| SMILES |
CC(C)=CCc1cc(/C=C/C(=O)c2ccc(O)cc2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina abussinica | Ref. |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
| Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
|
|
zoom in
| Organism | Erythrina abussinica |
|---|
| Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Xing, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 28, (2003), 593.
Yenesew, et al., Phytochemistry, 65, (2004), 3029.
Yenesew, et al., Planta Med, 69, (2003), 658 |
|---|
|
