| Name |
Ageconyflavone A 3',4'-Methylenedioxy-5,6,7-trimethoxyflavone 2-(1,3-Benzodioxol-5-yl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H16O7 |
| Mw |
356.08960287 |
| CAS RN |
106636-80-0 |
| C_ID |
C00013402
, 
|
| InChIKey |
UWMIBQBUKOVZNB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H16O7/c1-21-16-8-15-17(19(23-3)18(16)22-2)11(20)7-13(26-15)10-4-5-12-14(6-10)25-9-24-12/h4-8H,9H2,1-3H3 |
| SMILES |
COc1cc2oc(-c3ccc4c(c3)OCO4)cc(=O)c2c(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ageratum conyzoides  | Ref. |
| Plantae | Rutaceae | Neoraputia magnifica | Ref. |
| Plantae | Rutaceae | Neoraputia paraensis | Ref. |
|
|
zoom in
| Organism | Ageratina conyzoides | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|