| Name |
Tricetin 5,7,3',4',5'-Pentahydroxyflavone 5,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C15H10O7 |
| Mw |
302.04265268 |
| CAS RN |
520-31-0 |
| C_ID |
C00013328
, 
|
| InChIKey |
ARSRJFRKVXALTF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O7/c16-7-3-8(17)14-9(18)5-12(22-13(14)4-7)6-1-10(19)15(21)11(20)2-6/h1-5,16-17,19-21H |
| SMILES |
O=c1cc(-c2cc(O)c(O)c(O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Heliotropium subulatum | Ref. |
| Plantae | Boraginaceae | Heliotropium taltalense | Ref. |
| Plantae | Caryophyllaceae | Stellaria media  | Ref. |
| Plantae | Fabaceae | Lens culinaris  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Myrtaceae | Eucalyptus globulus  | Ref. |
| Plantae | Myrtaceae | Kunzea ericoides | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Metrosideros excelsa  | Ref. |
| Plantae | Myrtaceae | Metrosideros umbellata | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
| Organism | Heliotropium subulatum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|