| Name |
Ageconyflavone B 5,6,7,3'-Tetramethoxy-4'-hydroxyflavone 2-(4-Hydroxy-3-methoxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O7 |
| Mw |
358.10525293 |
| CAS RN |
51145-80-3 |
| C_ID |
C00013318
, 
|
| InChIKey |
DTWRFKKTAKDLCF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O7/c1-22-14-7-10(5-6-11(14)20)13-8-12(21)17-15(26-13)9-16(23-2)18(24-3)19(17)25-4/h5-9,20H,1-4H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(OC)c(OC)c(OC)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ageratum conyzoides  | Ref. |
|
|
zoom in
| Organism | Ageratina conyzoides | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|