| Name |
Telekin Telekine [3aR-(3aalpha,4aalpha,8abeta,9aalpha)]-Decahydro-4a-hydroxy-8a-methyl-3,5-bis(methylene)-naphtho[2,3-b]furan-2(3H)-one |
| Formula |
C15H20O3 |
| Mw |
248.1412445 |
| CAS RN |
6752-90-5 |
| C_ID |
C00012916
, 
|
| InChIKey |
LIDPBIULZNRIJE-FDWLVHDVNA-N |
| InChICode |
InChI=1S/C15H20O3/c1-9-5-4-6-14(3)8-12-11(7-15(9,14)17)10(2)13(16)18-12/h11-12,17H,1-2,4-8H2,3H3/t11-,12-,14-,15-/m1/s1 |
| SMILES |
C=C1C(=O)O[C@@H]2C[C@@]3(C)CCCC(=C)[C@]3(O)C[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Carpesium abrotanoides | Ref. |
| Plantae | Asteraceae | Helminthotheca echioides (L.) Holub | Ref. |
| Plantae | Asteraceae | Telekia speciosa | Ref. |
|
|
zoom in
| Organism | Carpesium abrotanoides | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|