| Name |
(E,E)-4,4,8-Trimethyl-2,8-cycloundecadien-1-one Rudbeckianone |
| Formula |
C14H22O |
| Mw |
206.16706532 |
| CAS RN |
70329-65-6 |
| C_ID |
C00012470
, 
|
| InChIKey |
DSPDFJOUMGPCOG-NBQJXQBYSA-N |
| InChICode |
InChI=1S/C14H22O/c1-12-6-4-8-13(15)9-11-14(2,3)10-5-7-12/h6,9,11H,4-5,7-8,10H2,1-3H3/b11-9+,12-6+ |
| SMILES |
C/C1=CCCC(=O)/C=C/C(C)(C)CCC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Blainvillea acmella | Ref. |
| Plantae | Asteraceae | Rudbeckia laciniata | Ref. |
|
|
zoom in
| Organism | Blainvillea acmella | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|