| Name |
Geijerene Geijeren |
| Formula |
C12H18 |
| Mw |
162.14085057 |
| CAS RN |
6902-73-4 |
| C_ID |
C00012025
, 
|
| InChIKey |
BGDQCKOAZKTOFV-WEUYFXHZNA-N |
| InChICode |
InChI=1S/C12H18/c1-5-12(4)9-7-6-8-11(12)10(2)3/h5-6,8,11H,1-2,7,9H2,3-4H3/t11-,12+/m0/s1 |
| SMILES |
C=C[C@]1(C)CCC=C[C@H]1C(=C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Rutaceae | Geijera parviflora | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
|
|
zoom in
| Organism | Origanum vulgare | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|