| Name |
beta-Bisabolol |
| Formula |
C15H26O |
| Mw |
222.19836545 |
| CAS RN |
15352-77-9 |
| C_ID |
C00011606
, 
|
| InChIKey |
WTVHAMTYZJGJLJ-PVRQQBJHNA-N |
| InChICode |
InChI=1S/C15H26O/c1-12(2)6-5-7-14(4)15(16)10-8-13(3)9-11-15/h6,8,14,16H,5,7,9-11H2,1-4H3/t14-,15+/m0/s1 |
| SMILES |
CC(C)=CCC[C@H](C)[C@@]1(O)CC=C(C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Malvaceae | Gossypium hirsutum  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Piperaceae | Peperomia sui | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
|
|
zoom in
| Organism | Ageratina conyzoides | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|