| Name |
Fumitremorgin C |
| Formula |
C22H25N3O3 |
| Mw |
379.18959169 |
| CAS RN |
118974-02-0 |
| C_ID |
C00011298
, 
|
| InChIKey |
DBEYVIGIPJSTOR-GSECYGIDNA-N |
| InChICode |
InChI=1S/C22H25N3O3/c1-12(2)9-18-20-15(14-7-6-13(28-3)10-16(14)23-20)11-19-21(26)24-8-4-5-17(24)22(27)25(18)19/h6-7,9-10,17-19,23H,4-5,8,11H2,1-3H3/t17-,18-,19-/m0/s1 |
| SMILES |
COc1ccc2c3c([nH]c2c1)[C@H](C=C(C)C)N1C(=O)[C@@H]2CCCN2C(=O)C1C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
| Fungi | Trichocomaceae | Aspergillus sydowi PFW1-13 | Ref. |
| Fungi | Trichocomaceae | Talaromyces sp. LGT-2 | Ref. |
|
|
zoom in
| Organism | Aspergillus fumigatus | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Cole,Handbook of Toxic Fungal Metabolites,(1981),364
Cole,Ann.Nutr.Alim.,31,(1977),685 |
|---|
|