| Name |
Fumigaclavine C (8S,9S)-Fumigaclavine C |
| Formula |
C23H30N2O2 |
| Mw |
366.23072822 |
| CAS RN |
62867-47-4 |
| C_ID |
C00011250
, 
|
| InChIKey |
OSICWVVWEXKSBD-SKJCSWKVNA-N |
| InChICode |
InChI=1S/C23H30N2O2/c1-7-23(4,5)22-16-11-18-20(15-9-8-10-17(24-22)19(15)16)21(27-14(3)26)13(2)12-25(18)6/h7-10,13,18,20-21,24H,1,11-12H2,2-6H3/t13-,18-,20-,21+/m1/s1 |
| SMILES |
C=CC(C)(C)c1[nH]c2cccc3c2c1C[C@@H]1[C@@H]3[C@@H](OC(C)=O)[C@H](C)CN1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
| Fungi | Trichocomaceae | Neosartorya fumigata | Ref. |
| - | - | Aspergullus fumigatus | Ref. |
| - | - | Isaria tenuipes BCC12625 | Ref. |
| - | - | Neosartarya fumigata Af293 | Ref. |
|
|
zoom in
| Organism | Aspergillus fumigatus | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Cole,Handbook of Toxic Fungal Metabolites,(1981),537 |
|---|
|