| Name |
Ergovaline EN |
| Formula |
C29H35N5O5 |
| Mw |
533.26381927 |
| CAS RN |
2873-38-3 |
| C_ID |
C00011228
, 
|
| InChIKey |
BGHDUTQZGWOQIA-NHFSJYMXNA-N |
| InChICode |
InChI=1S/C29H35N5O5/c1-15(2)24-26(36)33-10-6-9-22(33)29(38)34(24)27(37)28(3,39-29)31-25(35)17-11-19-18-7-5-8-20-23(18)16(13-30-20)12-21(19)32(4)14-17/h5,7-8,11,13,15,17,21-22,24,30,38H,6,9-10,12,14H2,1-4H3,(H,31,35)/t17-,21-,22+,24+,28-,29+/m1/s1 |
| SMILES |
CC(C)[C@H]1C(=O)N2CCC[C@H]2[C@]2(O)O[C@@](C)(NC(=O)[C@@H]3C=C4c5cccc6[nH]cc(c56)C[C@H]4N(C)C3)C(=O)N12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Clavicipitaceae | Claviceps purpurea  | Ref. |
| Fungi | Clavicipitaceae | Epichloe festucae | Ref. |
| Fungi | Clavicipitaceae | Epichloe typhina | Ref. |
| Fungi | Hypocreaceae | Acremonium coenophialum | Ref. |
| Plantae | Poaceae | Festuca arundinacea  | Ref. |
| - | - | Neotyphodium coenophialum | Ref. |
| - | - | Neotyphodium lolii | Ref. |
| - | - | Neotyphodium starrii | Ref. |
|
|
zoom in
| Organism | Claviceps purpurea | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Berde,Handbook of Experimental Pharmacology,Springer-Verlag New York,(1978) |
|---|
|