| Name |
Setoclavine |
| Formula |
C16H18N2O |
| Mw |
254.14191321 |
| CAS RN |
519-12-0 |
| C_ID |
C00011215
, 
|
| InChIKey |
BGVUWLLRNRBDAY-AQPSWHTGNA-N |
| InChICode |
InChI=1S/C16H18N2O/c1-16(19)7-12-11-4-3-5-13-15(11)10(8-17-13)6-14(12)18(2)9-16/h3-5,7-8,14,17,19H,6,9H2,1-2H3/t14-,16+/m1/s1 |
| SMILES |
CN1C[C@@](C)(O)C=C2c3cccc4[nH]cc(c34)C[C@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Clavicipitaceae | Claviceps purpurea  | Ref. |
| Plantae | Convolvulaceae | Argyreia nervosa  | Ref. |
| Plantae | Poaceae | Elymus mollis | Ref. |
| Plantae | Poaceae | Festuca rubra  | Ref. |
| Plantae | Poaceae | Pennisetum typhoideum  | Ref. |
| Plantae | Poaceae | Trisetum bifidum | Ref. |
| - | - | Agropyrum semicostatum | Ref. |
|
|
zoom in
| Organism | Claviceps purpurea | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|