| Name |
Tecomoside |
| Formula |
C16H24O10 |
| Mw |
376.13694699 |
| CAS RN |
55732-44-0 |
| C_ID |
C00010710
, 
|
| InChIKey |
FGGWCLCZRVUDMA-JEXUTUMVNA-N |
| InChICode |
InChI=1S/C16H24O10/c1-6-8(19)2-16(23)7(3-17)5-24-14(10(6)16)26-15-13(22)12(21)11(20)9(4-18)25-15/h3,5-6,8-15,18-23H,2,4H2,1H3/t6-,8-,9+,10-,11+,12-,13-,14-,15+,16-/m0/s1 |
| SMILES |
C[C@@H]1[C@H]2[C@H](O[C@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)OC=C(C=O)[C@@]2(O)C[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bignoniaceae | Campsis grandiflora | Ref. |
| Plantae | Bignoniaceae | Tecoma capensis | Ref. |
|
|
zoom in
| Organism | Campsis grandiflora |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
