| Name |
Shanzhiside |
| Formula |
C16H24O11 |
| Mw |
392.13186161 |
| CAS RN |
29836-27-9 |
| C_ID |
C00010686
, 
|
| InChIKey |
YSIFYNVXJOGADM-NDYSCQASNA-N |
| InChICode |
InChI=1S/C16H24O11/c1-16(24)2-6(18)8-5(13(22)23)4-25-14(9(8)16)27-15-12(21)11(20)10(19)7(3-17)26-15/h4,6-12,14-15,17-21,24H,2-3H2,1H3,(H,22,23)/t6-,7+,8+,9-,10-,11-,12+,14+,15+,16+/m1/s1 |
| SMILES |
C[C@]1(O)C[C@@H](O)[C@@H]2C(C(=O)O)=CO[C@@H](O[C@@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Barleria lupulina  | Ref. |
| Plantae | Orobanchaceae | Castilleja integra | Ref. |
| Plantae | Rubiaceae | Gardenia jasminoides  | Ref. |
| Plantae | Rubiaceae | Genipa americana  | Ref. |
|
|
zoom in
| Organism | Barleria lupulina | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Suksamrarn, et al., Planta Med, 69, (2003), 877 |
|---|
|