| Name |
Rehmannioside D |
| Formula |
C27H42O20 |
| Mw |
686.22694379 |
| CAS RN |
81720-08-3 |
| C_ID |
C00010626
, 
|
| InChIKey |
JQEFRKPLHFKTFL-CUHCJJBBNA-N |
| InChICode |
InChI=1S/C27H42O20/c28-4-8-3-12(32)27(1-2-41-23(13(8)27)46-25-21(40)18(37)15(34)10(6-30)43-25)47-26-22(19(38)16(35)11(7-31)44-26)45-24-20(39)17(36)14(33)9(5-29)42-24/h1-3,9-26,28-40H,4-7H2/t9-,10+,11+,12+,13-,14+,15+,16+,17-,18-,19-,20-,21-,22-,23-,24-,25+,26-,27-/m0/s1 |
| SMILES |
OCC1=C[C@@H](O)[C@]2(O[C@@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O[C@@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)C=CO[C@@H](O[C@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Clerodendrum inerme  | Ref. |
| Plantae | Plantaginaceae | Aragoa cundinamarcensis | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago maritima  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
|
|
zoom in
| Organism | Clerodendrum inerme | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Oshio, et al., Phytochemistry, 21, (1982), 133.
Chem Abstr, 120, (1994), P208577x.
Kanchanapoom, et al., Phytochemistry, 58, (2001), 333 |
|---|
|