| Name |
10-Acetylmonomelittoside |
| Formula |
C17H24O11 |
| Mw |
404.13186161 |
| CAS RN |
133024-10-9 |
| C_ID |
C00010620
, 
|
| InChIKey |
KYTISVZGNSQNDO-OXUQIIHUNA-N |
| InChICode |
InChI=1S/C17H24O11/c1-7(19)26-6-8-4-10(20)17(24)2-3-25-15(11(8)17)28-16-14(23)13(22)12(21)9(5-18)27-16/h2-4,9-16,18,20-24H,5-6H2,1H3/t9-,10+,11-,12+,13+,14-,15-,16+,17-/m0/s1 |
| SMILES |
CC(=O)OCC1=C[C@@H](O)[C@]2(O)C=CO[C@@H](O[C@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago media  | Ref. |
|
|
zoom in
| Organism | Plantago major | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|