| Name |
Reptoside |
| Formula |
C17H26O10 |
| Mw |
390.15259705 |
| CAS RN |
53839-03-5 |
| C_ID |
C00010573
, 
|
| InChIKey |
BZSUBLJAJWNODC-JADYKDECNA-N |
| InChICode |
InChI=1S/C17H26O10/c1-8(19)27-16(2)3-4-17(23)5-6-24-15(13(16)17)26-14-12(22)11(21)10(20)9(7-18)25-14/h5-6,9-15,18,20-23H,3-4,7H2,1-2H3/t9-,10-,11-,12+,13-,14-,15+,16+,17-/m1/s1 |
| SMILES |
CC(=O)O[C@@]1(C)CC[C@]2(O)C=CO[C@@H](O[C@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Eucommiaceae | Eucommia ulmoides  | Ref. |
| Plantae | Labiatae | Ajuga decumbens  | Ref. |
| Plantae | Labiatae | Ajuga reptans  | Ref. |
| Plantae | Verbenaceae | Clerodendron thomsonae | Ref. |
|
|
zoom in
| Organism | Eucommia ulmoides | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|