| Name |
Iridin Irigenin 7-O-glucoside |
| Formula |
C24H26O13 |
| Mw |
522.13734092 |
| CAS RN |
491-74-7 |
| C_ID |
C00010137
, 
|
| InChIKey |
LNQCUTNLHUQZLR-XFHPCMAINA-N |
| InChICode |
InChI=1S/C24H26O13/c1-32-13-5-9(4-11(26)22(13)33-2)10-8-35-12-6-14(23(34-3)19(29)16(12)17(10)27)36-24-21(31)20(30)18(28)15(7-25)37-24/h4-6,8,15,18,20-21,24-26,28-31H,7H2,1-3H3/t15-,18+,20-,21-,24+/m0/s1 |
| SMILES |
COc1cc(-c2coc3cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)c(OC)c(O)c3c2=O)cc(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Juniperus macropoda | Ref. |
| Plantae | Iridaceae | Belamcanda chinensis  | Ref. |
| Plantae | Iridaceae | Iris dichotoma | Ref. |
| Plantae | Iridaceae | Iris florentina | Ref. |
| Plantae | Iridaceae | Iris germanica  | Ref. |
| Plantae | Iridaceae | Iris komonoensis | Ref. |
| Plantae | Iridaceae | Iris unguicularis | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
|
|
zoom in
| Organism | Juniperus macropoda | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Dhar,Phytochem.,11,(1972),3097
Sethi,Phytochem.,19,(1980),1831 |
|---|
|