| Name |
Isoneorautenol 3-Hydroxy-6'',6''-dimethylpyrano[2'',3'':9,8]pterocarpan |
| Formula |
C20H18O4 |
| Mw |
322.12050906 |
| CAS RN |
998755-24-9 |
| C_ID |
C00010002
, 
|
| InChIKey |
WTKJOOHYNMPGLE-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H18O4/c1-20(2)6-5-11-7-14-15-10-22-17-8-12(21)3-4-13(17)19(15)23-18(14)9-16(11)24-20/h3-9,15,19,21H,10H2,1-2H3/t15-,19-/m1/s1 |
| SMILES |
CC1(C)C=Cc2cc3c(cc2O1)OC1c2ccc(O)cc2OCC31 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Calopogonium mucunoides | Ref. |
| Plantae | Fabaceae | Erythrina eriotriocha | Ref. |
| Plantae | Fabaceae | Erythrina lysistemon  | Ref. |
| Plantae | Fabaceae | Sophora prostrata | Ref. |
| Plantae | Fabaceae | Sophora tetraptera  | Ref. |
|
|
zoom in
| Organism | Calopogonium mucunoides | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ingham,Z.Naturforsch.C,40,(1985),482 |
|---|
|