| Name |
Bolusanthin 3,5,7,3'-Tetrahydroxy-4'-methoxyisoflavone |
| Formula |
C16H14O7 |
| Mw |
318.0739528 |
| CAS RN |
99365-26-1 |
| C_ID |
C00009955
, 
|
| InChIKey |
XCIMIGGTZKYBOR-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O7/c1-22-12-3-2-8(4-10(12)18)16(21)7-23-13-6-9(17)5-11(19)14(13)15(16)20/h2-6,17-19,21H,7H2,1H3/t16-/m1/s1 |
| SMILES |
COc1ccc(C2(O)COc3cc(O)cc(O)c3C2=O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Bolusanthus speciosus | Ref. |
| Plantae | Fabaceae | Bolusanthus specious | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
|
|
zoom in
| Organism | Bolusanthus speciosus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Asres,Z.Naturforsch.C,40,(1985),617 |
|---|
|