| Name |
6-C-prenylorobol 5,7,3',4'-Tetrahydroxy-6-prenylisoflavone |
| Formula |
C20H18O6 |
| Mw |
354.11033831 |
| CAS RN |
66777-71-7 |
| C_ID |
C00009890
, 
|
| InChIKey |
URGGLJWRKAXLOT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O6/c1-10(2)3-5-12-15(22)8-17-18(19(12)24)20(25)13(9-26-17)11-4-6-14(21)16(23)7-11/h3-4,6-9,21-24H,5H2,1-2H3 |
| SMILES |
CC(C)=CCc1c(O)cc2occ(-c3ccc(O)c(O)c3)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Wyethia angustifolia | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Wyethia angustifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
McCormick,Phytochem.,25,(1986),1723 |
|---|
|