| Name |
Semilicoisoflavone B |
| Formula |
C20H16O6 |
| Mw |
352.09468824 |
| CAS RN |
129280-33-7 |
| C_ID |
C00009880
, 
|
| InChIKey |
LWZACZCRAUQSLH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H16O6/c1-20(2)4-3-10-5-11(6-15(23)19(10)26-20)13-9-25-16-8-12(21)7-14(22)17(16)18(13)24/h3-9,21-23H,1-2H3 |
| SMILES |
CC1(C)C=Cc2cc(-c3coc4cc(O)cc(O)c4c3=O)cc(O)c2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza aspera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
| Plantae | Fabaceae | Glycyrrhiza sp. | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza aspera |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Xing, et al., CCMM, 28, (2003), 593
Zeng,Heterocycles,34,(1992),575 |
|---|
|
