| Name |
Isowighteone 3'-Prenylgenistein 5,7,4'-Trihydroxy-3'-prenylisoflavone |
| Formula |
C20H18O5 |
| Mw |
338.11542369 |
| CAS RN |
68436-47-5 |
| C_ID |
C00009831
, 
|
| InChIKey |
SWDSVBNAMCDHTF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O5/c1-11(2)3-4-13-7-12(5-6-16(13)22)15-10-25-18-9-14(21)8-17(23)19(18)20(15)24/h3,5-10,21-23H,4H2,1-2H3 |
| SMILES |
CC(C)=CCc1cc(-c2coc3cc(O)cc(O)c3c2=O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cajanus cajan  | Ref. |
| Plantae | Fabaceae | Erythrina vogelii | Ref. |
| Plantae | Fabaceae | Glycyrrhiza aspera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Piscidia erythrina | Ref. |
| Plantae | Fabaceae | Ulex airensis | Ref. |
| Plantae | Fabaceae | Ulex europaeus subsp. europaeus  | Ref. |
|
|
zoom in
| Organism | Cajanus cajan | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Dahiya,Phytochem.,23,(1984),871
Ingham,Z.Naturforsch.C,44,(1989),905 |
|---|
|