| Name |
7,2'-Dihydroxy-4'-methoxy-3-phenylcoumarin |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
54300-95-7 |
| C_ID |
C00009781
, 
|
| InChIKey |
CSQQQDLQNMHAPD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-11-4-5-12(14(18)8-11)13-6-9-2-3-10(17)7-15(9)21-16(13)19/h2-8,17-18H,1H3 |
| SMILES |
COc1ccc(-c2cc3ccc(O)cc3oc2=O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia oliveri | Ref. |
| Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fabaceae | Zollernia paraensis | Ref. |
|
|
zoom in
| Organism | Dalbergia oliveri | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Donnelly,Phytochem.,13,(1974),2587 |
|---|
|