| Name |
1-O-Methylglycyrol 5-O-Methylglycyrol 9-Hydroxy-1,3-dimethoxy-2-prenylcoumestan 3-O-Methylglycyrol |
| Formula |
C22H20O6 |
| Mw |
380.12598837 |
| CAS RN |
23013-85-6 |
| C_ID |
C00009780
, 
|
| InChIKey |
ACDSUMGMZHXCRO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H20O6/c1-11(2)5-7-14-15(25-3)10-17-19(20(14)26-4)21-18(22(24)28-17)13-8-6-12(23)9-16(13)27-21/h5-6,8-10,23H,7H2,1-4H3 |
| SMILES |
COc1cc2oc(=O)c3c4ccc(O)cc4oc3c2c(OC)c1CC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza spp. | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza glabra | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|