| Name |
Sophoracoumestan A |
| Formula |
C20H14O5 |
| Mw |
334.08412356 |
| CAS RN |
77369-93-8 |
| C_ID |
C00009774
, 
|
| InChIKey |
JOMJKDWBAPDZIF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H14O5/c1-20(2)6-5-10-7-13-16(9-14(10)25-20)23-18-12-4-3-11(21)8-15(12)24-19(22)17(13)18/h3-9,21H,1-2H3 |
| SMILES |
CC1(C)C=Cc2cc3c(cc2O1)oc1c2ccc(O)cc2oc(=O)c31 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
| Plantae | Fabaceae | Sophora franchetiana | Ref. |
|
|
zoom in
| Organism | Psoralea corylifolia |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
