| Name |
Tuberosin (+)-Tuberosine |
| Formula |
C20H18O5 |
| Mw |
338.11542369 |
| CAS RN |
41347-45-9 |
| C_ID |
C00009684
, 
|
| InChIKey |
ZBTYHECJEINCMD-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H18O5/c1-19(2)6-5-11-7-14-17(9-15(11)25-19)24-18-13-4-3-12(21)8-16(13)23-10-20(14,18)22/h3-9,18,21-22H,10H2,1-2H3/t18-,20+/m0/s1 |
| SMILES |
CC1(C)C=Cc2cc3c(cc2O1)OC1c2ccc(O)cc2OCC31O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Pueraria lobata  | Ref. |
| Plantae | Fabaceae | Pueraria mirifica  | Ref. |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
| Plantae | Fabaceae | Pueraria thunbergiana  | Ref. |
| Plantae | Fabaceae | Pueraria tuberosa  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
|
|
zoom in
| Organism | Pueraria lobata | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986) |
|---|
|