| Name |
Clandestacarpin |
| Formula |
C20H16O5 |
| Mw |
336.09977362 |
| CAS RN |
79002-16-7 |
| C_ID |
C00009683
, 
|
| InChIKey |
JHGGFHPIFBPWNE-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H16O5/c1-10(2)16-8-13-15(24-16)6-4-12-18(13)23-9-20(22)14-5-3-11(21)7-17(14)25-19(12)20/h3-8,19,21-22H,1,9H2,2H3/t19-,20-/m0/s1 |
| SMILES |
C=C(C)c1cc2c3c(ccc2o1)C1Oc2cc(O)ccc2C1(O)CO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycine clandestina | Ref. |
| Plantae | Fabaceae | Glycine tabacina | Ref. |
| Plantae | Fabaceae | Glycine tomentella | Ref. |
|
|
zoom in
| Organism | Glycine clandestina | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Lyne,Tetrahedron Lett.,(1981),2483
Ingham,Fortschr.Chem.Org.Naturst.,43,(1983),1 |
|---|
|