| Name |
2-Methoxypterocarpin 2,3-Dimethoxy-8,9-methylenedioxypterocarpan |
| Formula |
C18H16O6 |
| Mw |
328.09468824 |
| CAS RN |
30461-93-9 |
| C_ID |
C00009629
, 
|
| InChIKey |
HPRCMYHWQYUZKB-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C18H16O6/c1-19-14-4-10-12(5-15(14)20-2)21-7-11-9-3-16-17(23-8-22-16)6-13(9)24-18(10)11/h3-6,11,18H,7-8H2,1-2H3/t11-,18-/m0/s1 |
| SMILES |
COc1cc2c(cc1OC)C1Oc3cc4c(cc3C1CO2)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Neorautanenia edulis | Ref. |
| Plantae | Fabaceae | Ulex airensis | Ref. |
| Plantae | Fabaceae | Ulex europaeus subsp. europaeus  | Ref. |
|
|
zoom in
| Organism | Neorautanenia edulis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Rall,J.S.Afr.Chem.Inst.,25,(1972),25 |
|---|
|