| Name |
11-Hydroxytephrosin |
| Formula |
C23H22O8 |
| Mw |
426.13146768 |
| CAS RN |
72458-85-6 |
| C_ID |
C00009591
, 
|
| InChIKey |
OFLCPNIRDVOOEZ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C23H22O8/c1-22(2)6-5-11-14(31-22)8-13(24)19-20(11)30-18-10-29-15-9-17(28-4)16(27-3)7-12(15)23(18,26)21(19)25/h5-9,18,24,26H,10H2,1-4H3/t18-,23+/m1/s1 |
| SMILES |
COc1cc2c(cc1OC)C1(O)C(=O)c3c(O)cc4c(c3OC1CO2)C=CC(C)(C)O4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Amorpha fruticosa | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Tephrosia toxicaria | Ref. |
| Plantae | Fabaceae | Tephrosia villosa  | Ref. |
|
|
zoom in
| Organism | Amorpha fruticosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Mitscher,Heterocycles,12,(1979),1033 |
|---|
|