| Name |
Isoferreirin |
| Formula |
C16H14O6 |
| Mw |
302.07903818 |
| CAS RN |
76656-75-2 |
| C_ID |
C00009554
, 
|
| InChIKey |
VODZWHSRITUHNI-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O6/c1-21-13-5-8(17)2-3-10(13)11-7-22-14-6-9(18)4-12(19)15(14)16(11)20/h2-6,11,17-19H,7H2,1H3/t11-/m0/s1 |
| SMILES |
COc1cc(O)ccc1C1COc2cc(O)cc(O)c2C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dolichos biflorus  | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus | Ref. |
| Plantae | Fabaceae | Uraria picta | Ref. |
| - | - | Stizolobium deeringianum | Ref. |
|
|
zoom in
| Organism | Dolichos biflorus |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Keen,Z.Naturforsch.C,35,(1980),923 |
|---|
|
