| Name |
Dihydrobiochanin A |
| Formula |
C16H14O5 |
| Mw |
286.08412356 |
| CAS RN |
66152-07-6 |
| C_ID |
C00009553
, 
|
| InChIKey |
XPZQBSCTDLGDBP-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O5/c1-20-11-4-2-9(3-5-11)12-8-21-14-7-10(17)6-13(18)15(14)16(12)19/h2-7,12,17-18H,8H2,1H3/t12-/m0/s1 |
| SMILES |
COc1ccc(C2COc3cc(O)cc(O)c3C2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Andira parviflora | Ref. |
| Plantae | Fabaceae | Swartzia polyphylla | Ref. |
| Plantae | Poaceae | Gynerium sagittatum  | Ref. |
|
|
zoom in
| Organism | Andira parviflora | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Braz Filho,Phytochem.,12,(1973),1184 |
|---|
|