| Name |
Dihydroformononetin 7-Hydroxy-4'-methoxyisoflavanone |
| Formula |
C16H14O4 |
| Mw |
270.08920894 |
| CAS RN |
4626-22-6 |
| C_ID |
C00009534
, 
|
| InChIKey |
INYISIYHXQDCPK-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O4/c1-19-12-5-2-10(3-6-12)14-9-20-15-8-11(17)4-7-13(15)16(14)18/h2-8,14,17H,9H2,1H3/t14-/m1/s1 |
| SMILES |
COc1ccc(C2COc3cc(O)ccc3C2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Myroxylon balsamum  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Virgilia oroboides | Ref. |
| Plantae | Fabaceae | Zollernia paraensis | Ref. |
|
|
zoom in
| Organism | Myroxylon balsamum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Braga de Oliveira,Phytochem.,17,(1978),593 |
|---|
|