| Name |
Lisetin |
| Formula |
C21H18O7 |
| Mw |
382.10525293 |
| CAS RN |
6502-79-0 |
| C_ID |
C00009531
, 
|
| InChIKey |
KOHGMAFQELVQRG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H18O7/c1-9(2)4-5-11-18(24)15(26-3)8-12-16-19(25)17-13(23)6-10(22)7-14(17)27-21(16)28-20(11)12/h4,6-8,22-24H,5H2,1-3H3 |
| SMILES |
COc1cc2c(oc3oc4cc(O)cc(O)c4c(=O)c32)c(CC=C(C)C)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Piscidia communis | Ref. |
| Plantae | Fabaceae | Piscidia erythrina | Ref. |
| Plantae | Fabaceae | Piscidia piscipula  | Ref. |
|
|
zoom in
| Organism | Piscidia communis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Falshaw,Tetrahedron (Suppl.7),(1966),333
Moore,J.Am.Chem.Soc.,78,(1956),395 |
|---|
|