| Name |
Erythrinin C |
| Formula |
C20H18O6 |
| Mw |
354.11033831 |
| CAS RN |
63807-85-2 |
| C_ID |
C00009501
, 
|
| InChIKey |
NNBVKGDFOQADTG-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H18O6/c1-20(2,24)16-7-12-14(26-16)8-15-17(18(12)22)19(23)13(9-25-15)10-3-5-11(21)6-4-10/h3-6,8-9,16,21-22,24H,7H2,1-2H3/t16-/m0/s1 |
| SMILES |
CC(C)(O)C1Cc2c(cc3occ(-c4ccc(O)cc4)c(=O)c3c2O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina variegata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Moraceae | Ficus nymphaeifolia  | Ref. |
|
|
zoom in
| Organism | Erythrina variegata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Deshpande,Indian J.Chem.Sect.B,15,(1977),205 |
|---|
|