| Name |
Junipegenin B Dalspinosin 5,7-Dihydroxy-6,3',4'-trimethoxyisoflavone |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
78134-85-7 |
| C_ID |
C00009480
, 
|
| InChIKey |
MZERYTHMEZCPQG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-12-5-4-9(6-13(12)23-2)10-8-25-14-7-11(19)18(24-3)17(21)15(14)16(10)20/h4-8,19,21H,1-3H3 |
| SMILES |
COc1ccc(-c2coc3cc(O)c(OC)c(O)c3c2=O)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Juniperus macropoda | Ref. |
| Plantae | Fabaceae | Dalbergia spinosa | Ref. |
| Plantae | Iridaceae | Iris japonica  | Ref. |
| Plantae | Iridaceae | Iris kashmiriana | Ref. |
|
|
zoom in
| Organism | Juniperus macropoda | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Sethi,Phyothcem.,20,(1981),341 |
|---|
|