| Name |
5-Methoxyafrormosin 7-Hydroxy-5,6,4'-trimethoxyisoflavone |
| Formula |
C18H16O6 |
| Mw |
328.09468824 |
| CAS RN |
53505-61-6 |
| C_ID |
C00009470
, 
|
| InChIKey |
CHDLFAIVPUPGAT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)12-9-24-14-8-13(19)17(22-2)18(23-3)15(14)16(12)20/h4-9,19H,1-3H3 |
| SMILES |
COc1ccc(-c2coc3cc(O)c(OC)c(OC)c3c2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cladrastis platycarpa | Ref. |
| Plantae | Fabaceae | Cladrastis sikokiana | Ref. |
| Plantae | Fabaceae | Wisteria floribunda  | Ref. |
|
|
zoom in
| Organism | Cladrastis platycarpa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ohashi,J.Jpn.Wood Res.Soc.,20,(1974),336
Imamura,Phytochem.,13,(1974),757 |
|---|
|