| Name |
Isotectorigenin Pseudotectorigenin 5,7,4'-Trihydroxy-8-methoxyisoflavone |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
13111-57-4 |
| C_ID |
C00009460
, 
|
| InChIKey |
UYLQOGTYNFVQQX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-15-12(19)6-11(18)13-14(20)10(7-22-16(13)15)8-2-4-9(17)5-3-8/h2-7,17-19H,1H3 |
| SMILES |
COc1c(O)cc(O)c2c(=O)c(-c3ccc(O)cc3)coc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia sissoo  | Ref. |
| Plantae | Iridaceae | Belamcanda chinensis  | Ref. |
| - | - | Nocardiopsis sp. | Ref. |
| - | - | Stemphilium sp. No. 644 | Ref. |
|
|
zoom in
| Organism | Dalbergia sissoo | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Dhinga,Indian J.Org.,12,(1974),1118 |
|---|
|