| Name |
6,7,3',4'-Tetramethoxyisoflavone |
| Formula |
C19H18O6 |
| Mw |
342.11033831 |
| CAS RN |
24126-93-0 |
| C_ID |
C00009420
, 
|
| InChIKey |
OYSKBZHHLYECLU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O6/c1-21-14-6-5-11(7-16(14)22-2)13-10-25-15-9-18(24-4)17(23-3)8-12(15)19(13)20/h5-10H,1-4H3 |
| SMILES |
COc1ccc(-c2coc3cc(OC)c(OC)cc3c2=O)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Cordia africana  | Ref. |
| Plantae | Fabaceae | Ateleia herbert-smithii | Ref. |
| Plantae | Fabaceae | Cordyla africana L. | Ref. |
| Plantae | Fabaceae | Pterodon apparicioi | Ref. |
| Plantae | Fabaceae | Pterodon emarginatus Vogel | Ref. |
| Plantae | Fabaceae | Pterodon pubescens | Ref. |
|
|
zoom in
| Organism | Cordia africana |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Braz Filho,Phytochem.,10,(1971),2835
Leite de Almeida,Phytochem.,14,(1975),2716 |
|---|
|
