| Name |
Dalpatein |
| Formula |
C18H14O7 |
| Mw |
342.0739528 |
| CAS RN |
40009-88-9 |
| C_ID |
C00009419
, 
|
| InChIKey |
GYUPEJCNVAKZSU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H14O7/c1-21-13-6-17-16(24-8-25-17)3-9(13)11-7-23-14-5-12(19)15(22-2)4-10(14)18(11)20/h3-7,19H,8H2,1-2H3 |
| SMILES |
COc1cc2c(=O)c(-c3cc4c(cc3OC)OCO4)coc2cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia paniculata  | Ref. |
| Plantae | Fabaceae | Millettia pachyloba | Ref. |
| Plantae | Fabaceae | Piscidia erythrina | Ref. |
| Plantae | Fabaceae | Piscidia piscipula  | Ref. |
|
|
zoom in
| Organism | Dalbergia paniculata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Adinarayana,Indian J.Chem.,13,(1975),425
Radhakrishniah,Phytochem.,12,(1973),3003 |
|---|
|