| Name |
7-Hydroxy-2',4',5'-trimethoxyisoflavone |
| Formula |
C18H16O6 |
| Mw |
328.09468824 |
| CAS RN |
29096-94-4 |
| C_ID |
C00009413
, 
|
| InChIKey |
IXZYJZHCXHSCDY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O6/c1-21-14-8-17(23-3)16(22-2)7-12(14)13-9-24-15-6-10(19)4-5-11(15)18(13)20/h4-9,19H,1-3H3 |
| SMILES |
COc1cc(OC)c(-c2coc3cc(O)ccc3c2=O)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Amorpha fruticosa | Ref. |
| Plantae | Fabaceae | Dalbergia monetaria  | Ref. |
| Plantae | Fabaceae | Eysenhardtia polystachya | Ref. |
|
|
zoom in
| Organism | Amorpha fruticosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Crombie,J.Chem.Soc.Perkin Trans.,1,(1973),1285
Abe,Phytochem.,24,(1985),1071 |
|---|
|