| Name |
Fujikinetin methyl ether 6,7-Dimethoxy-3',4'-(methylenedioxy)isoflavone |
| Formula |
C18H14O6 |
| Mw |
326.07903818 |
| CAS RN |
2746-85-2 |
| C_ID |
C00009411
, 
|
| InChIKey |
ABOSSEFROBUJKH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H14O6/c1-20-15-6-11-14(7-16(15)21-2)22-8-12(18(11)19)10-3-4-13-17(5-10)24-9-23-13/h3-8H,9H2,1-2H3 |
| SMILES |
COc1cc2occ(-c3ccc4c(c3)OCO4)c(=O)c2cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Cordia africana  | Ref. |
| Plantae | Fabaceae | Ateleia herbert-smithii | Ref. |
| Plantae | Fabaceae | Cordyla africana L.  | Ref. |
| Plantae | Fabaceae | Pterodon emarginatus Vogel | Ref. |
|
|
zoom in
| Organism | Cordia africana | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Campbell,J.Chem.Soc.C.,(1969),1787 |
|---|
|