| Name |
Fujikinetin 7-Hydroxy-6-methoxy-3',4'-methylenedioxyisoflavone |
| Formula |
C17H12O6 |
| Mw |
312.06338812 |
| CAS RN |
38965-66-1 |
| C_ID |
C00009406
, 
|
| InChIKey |
QMDVDQRHFDCVKB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H12O6/c1-20-15-5-10-14(6-12(15)18)21-7-11(17(10)19)9-2-3-13-16(4-9)23-8-22-13/h2-7,18H,8H2,1H3 |
| SMILES |
COc1cc2c(=O)c(-c3ccc4c(c3)OCO4)coc2cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cladrastis platycarpa | Ref. |
| Plantae | Fabaceae | Dalbergia frutescens | Ref. |
| Plantae | Fabaceae | Dalbergia riparia | Ref. |
| Plantae | Fabaceae | Dalbergia sericea | Ref. |
| Plantae | Fabaceae | Millettia conraui  | Ref. |
| Plantae | Fabaceae | Millettia griffoniana | Ref. |
| Plantae | Fabaceae | Pterodon apparicioi | Ref. |
|
|
zoom in
| Organism | Cladrastis platycarpa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Imamura,J.Jpn Wood Res.Soc.,19,(1973),293
Galina,Phytochem.,13,(1974),2593 |
|---|
|