| Name |
Cuneatin Maximaisoflavone G |
| Formula |
C17H12O6 |
| Mw |
312.06338812 |
| CAS RN |
7741-28-8 |
| C_ID |
C00009404
, 
|
| InChIKey |
BHIIMRBCELSOFD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H12O6/c1-20-13-6-16-15(22-8-23-16)5-11(13)12-7-21-14-4-9(18)2-3-10(14)17(12)19/h2-7,18H,8H2,1H3 |
| SMILES |
COc1cc2c(cc1-c1coc3cc(O)ccc3c1=O)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cicer cuneatum | Ref. |
| Plantae | Fabaceae | Dalbergia frutescens | Ref. |
| Plantae | Fabaceae | Eysenhardtia polystachya | Ref. |
| Plantae | Fabaceae | Millettia griffoniana | Ref. |
| Plantae | Fabaceae | Millettia oblata ssp. teitensis  | Ref. |
| Plantae | Fabaceae | Millettia usaramensis subsp. usaramensis  | Ref. |
|
|
zoom in
| Organism | Cicer cuneatum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ingham,Biochem.Syst.Ecol.,9,(1981),125 |
|---|
|